C11H15BrN2O — CID 87428069
(2S)-4-(6-bromo-2-pyridinyl)-2,6-dimethylmorpholine (PubChem CID 87428069) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is (2S)-4-(6-bromo-2-pyridinyl)-2,6-dimethylmorpholine.
| Compound Name | (2S)-4-(6-bromo-2-pyridinyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 87428069 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2S)-4-(6-bromo-2-pyridinyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2cccc(Br)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15BrN2O/c1-8-6-14(7-9(2)15-8)11-5-3-4-10(12)13-11/h3-5,8-9H,6-7H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | OMHYHPZGWPNZOV-IENPIDJESA-N |
| XLogP | 2.46 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|