About [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane
[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane (PubChem CID 156818112) has the molecular formula C14H24N2OSn
and a molecular weight of 355.07 g/mol. Its IUPAC name is [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane.
Molecular Properties
| Compound Name | [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane |
| PubChem CID | 156818112 |
| Molecular Formula | C14H24N2OSn |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane |
| SMILES | C[C@@H]1CN(c2cccc([Sn](C)(C)C)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15N2O.3CH3.Sn/c1-9-7-13(8-10(2)14-9)11-5-3-4-6-12-11;;;;/h3-5,9-10H,7-8H2,1-2H3;3*1H3;/t9-,10+;;;; |
| InChIKey | CRLDJUDXKDEVJZ-GUQANJBTSA-N |
| XLogP | 2.24 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane?
The IUPAC name of [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane (CID 156818112) is [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane.
What is the SMILES notation for [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane?
The canonical SMILES for [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane is C[C@@H]1CN(c2cccc([Sn](C)(C)C)n2)C[C@H](C)O1.
What is the InChIKey of [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane?
The InChIKey is CRLDJUDXKDEVJZ-GUQANJBTSA-N. The full InChI is InChI=1S/C11H15N2O.3CH3.Sn/c1-9-7-13(8-10(2)14-9)11-5-3-4-6-12-11;;;;/h3-5,9-10H,7-8H2,1-2H3;3*1H3;/t9-,10+;;;;.
What are the key properties of [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane?
[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane has a molecular weight of 355.07 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-trimethylstannane is sourced from PubChem (CID 156818112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).