C11H15BrN2 — CID 151614904
2-bromo-6-(2,5-dimethylpyrrolidin-1-yl)pyridine (PubChem CID 151614904) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 2-bromo-6-(2,5-dimethylpyrrolidin-1-yl)pyridine.
| Compound Name | 2-bromo-6-(2,5-dimethylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 151614904 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-bromo-6-(2,5-dimethylpyrrolidin-1-yl)pyridine |
| SMILES | CC1CCC(C)N1c1cccc(Br)n1 |
| InChI | InChI=1S/C11H15BrN2/c1-8-6-7-9(2)14(8)11-5-3-4-10(12)13-11/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | QNGZRSPXOMACFN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|