C12H17BrN2 — CID 170582340
2-bromo-6-[(5S)-3,5-dimethylpiperidin-1-yl]pyridine (PubChem CID 170582340) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-bromo-6-[(5S)-3,5-dimethylpiperidin-1-yl]pyridine.
| Compound Name | 2-bromo-6-[(5S)-3,5-dimethylpiperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 170582340 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-bromo-6-[(5S)-3,5-dimethylpiperidin-1-yl]pyridine |
| SMILES | CC1C[C@H](C)CN(c2cccc(Br)n2)C1 |
| InChI | InChI=1S/C12H17BrN2/c1-9-6-10(2)8-15(7-9)12-5-3-4-11(13)14-12/h3-5,9-10H,6-8H2,1-2H3/t9-,10?/m0/s1 |
| InChIKey | NJGGCRRNCASGNW-RGURZIINSA-N |
| XLogP | 3.33 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|