C12H20N4 — CID 80928296
[6-(3,5-dimethylpiperidin-1-yl)-2-pyridinyl]hydrazine (PubChem CID 80928296) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is [6-(3,5-dimethylpiperidin-1-yl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(3,5-dimethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80928296 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [6-(3,5-dimethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
| SMILES | CC1CC(C)CN(c2cccc(NN)n2)C1 |
| InChI | InChI=1S/C12H20N4/c1-9-6-10(2)8-16(7-9)12-5-3-4-11(14-12)15-13/h3-5,9-10H,6-8,13H2,1-2H3,(H,14,15) |
| InChIKey | JWCOQANAKIWFRJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|