C13H23N5 — CID 80905621
1-[1-(6-hydrazinyl-2-pyridinyl)piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 80905621) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[1-(6-hydrazinyl-2-pyridinyl)piperidin-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-(6-hydrazinyl-2-pyridinyl)piperidin-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 80905621 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-[1-(6-hydrazinyl-2-pyridinyl)piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCN(c2cccc(NN)n2)CC1 |
| InChI | InChI=1S/C13H23N5/c1-17(2)10-11-6-8-18(9-7-11)13-5-3-4-12(15-13)16-14/h3-5,11H,6-10,14H2,1-2H3,(H,15,16) |
| InChIKey | DCDGJETYENDLLF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|