C16H19BrN2S — CID 107085236
4-[3-(bromomethyl)quinolin-2-yl]-2,3-dimethylthiomorpholine (PubChem CID 107085236) has the molecular formula C16H19BrN2S and a molecular weight of 351.31 g/mol. Its IUPAC name is 4-[3-(bromomethyl)quinolin-2-yl]-2,3-dimethylthiomorpholine.
| Compound Name | 4-[3-(bromomethyl)quinolin-2-yl]-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 107085236 |
| Molecular Formula | C16H19BrN2S |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-[3-(bromomethyl)quinolin-2-yl]-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(c2nc3ccccc3cc2CBr)C1C |
| InChI | InChI=1S/C16H19BrN2S/c1-11-12(2)20-8-7-19(11)16-14(10-17)9-13-5-3-4-6-15(13)18-16/h3-6,9,11-12H,7-8,10H2,1-2H3 |
| InChIKey | GJBBXZHXBHWNBT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|