C16H18N2OS — CID 95630049
[(2S,3R)-2,3-dimethylthiomorpholin-4-yl]-quinolin-2-ylmethanone (PubChem CID 95630049) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is [(2S,3R)-2,3-dimethylthiomorpholin-4-yl]-quinolin-2-ylmethanone.
| Compound Name | [(2S,3R)-2,3-dimethylthiomorpholin-4-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 95630049 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [(2S,3R)-2,3-dimethylthiomorpholin-4-yl]-quinolin-2-ylmethanone |
| SMILES | C[C@@H]1SCCN(C(=O)c2ccc3ccccc3n2)[C@@H]1C |
| InChI | InChI=1S/C16H18N2OS/c1-11-12(2)20-10-9-18(11)16(19)15-8-7-13-5-3-4-6-14(13)17-15/h3-8,11-12H,9-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | TXSHZFWLNWFILN-NEPJUHHUSA-N |
| XLogP | 3.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |