C17H20N2O — CID 40744893
[(3R,5R)-3,5-dimethylpiperidin-1-yl]-quinolin-2-ylmethanone (PubChem CID 40744893) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is [(3R,5R)-3,5-dimethylpiperidin-1-yl]-quinolin-2-ylmethanone.
| Compound Name | [(3R,5R)-3,5-dimethylpiperidin-1-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 40744893 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [(3R,5R)-3,5-dimethylpiperidin-1-yl]-quinolin-2-ylmethanone |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)c2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C17H20N2O/c1-12-9-13(2)11-19(10-12)17(20)16-8-7-14-5-3-4-6-15(14)18-16/h3-8,12-13H,9-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | XOPKODAFDYQOED-CHWSQXEVSA-N |
| XLogP | 3.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |