C15H15FN2O — CID 171530362
[(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-quinolin-2-ylmethanone (PubChem CID 171530362) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-quinolin-2-ylmethanone.
| Compound Name | [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 171530362 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(2R,4S)-4-fluoro-2-methylpyrrolidin-1-yl]-quinolin-2-ylmethanone |
| SMILES | C[C@@H]1C[C@H](F)CN1C(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H15FN2O/c1-10-8-12(16)9-18(10)15(19)14-7-6-11-4-2-3-5-13(11)17-14/h2-7,10,12H,8-9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | JTYBACCBBVGRTM-PWSUYJOCSA-N |
| XLogP | 2.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |