C14H14N2OS — CID 122331673
(2-methyl-1,3-thiazolidin-3-yl)-quinolin-2-ylmethanone (PubChem CID 122331673) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is (2-methyl-1,3-thiazolidin-3-yl)-quinolin-2-ylmethanone.
| Compound Name | (2-methyl-1,3-thiazolidin-3-yl)-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 122331673 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2-methyl-1,3-thiazolidin-3-yl)-quinolin-2-ylmethanone |
| SMILES | CC1SCCN1C(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H14N2OS/c1-10-16(8-9-18-10)14(17)13-7-6-11-4-2-3-5-12(11)15-13/h2-7,10H,8-9H2,1H3 |
| InChIKey | FXIDSJFEZJTGDI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |