C19H23N3O — CID 129427982
[(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-quinolin-2-ylmethanone (PubChem CID 129427982) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is [(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-quinolin-2-ylmethanone.
| Compound Name | [(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 129427982 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]-quinolin-2-ylmethanone |
| SMILES | CN1CCC[C@H]1[C@H]1CCCN1C(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H23N3O/c1-21-12-4-8-17(21)18-9-5-13-22(18)19(23)16-11-10-14-6-2-3-7-15(14)20-16/h2-3,6-7,10-11,17-18H,4-5,8-9,12-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | LKCRJJVGYFDJEI-ZWKOTPCHSA-N |
| XLogP | 2.93 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |