C18H20N2OS — CID 90616065
(3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-quinolin-2-ylmethanone (PubChem CID 90616065) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-quinolin-2-ylmethanone.
| Compound Name | (3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 90616065 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (3-methylsulfanyl-8-azabicyclo[3.2.1]octan-8-yl)-quinolin-2-ylmethanone |
| SMILES | CSC1CC2CCC(C1)N2C(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H20N2OS/c1-22-15-10-13-7-8-14(11-15)20(13)18(21)17-9-6-12-4-2-3-5-16(12)19-17/h2-6,9,13-15H,7-8,10-11H2,1H3 |
| InChIKey | XRKYNCACBLPQSZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |