C32H37N3OP+ — CID 4064702
triphenyl-[5-piperidin-1-yl-2-(piperidin-1-ylmethyl)-1,3-oxazol-4-yl]phosphanium (PubChem CID 4064702) has the molecular formula C32H37N3OP+ and a molecular weight of 510.64 g/mol. Its IUPAC name is triphenyl-[5-piperidin-1-yl-2-(piperidin-1-ylmethyl)-1,3-oxazol-4-yl]phosphanium.
| Compound Name | triphenyl-[5-piperidin-1-yl-2-(piperidin-1-ylmethyl)-1,3-oxazol-4-yl]phosphanium |
|---|---|
| PubChem CID | 4064702 |
| Molecular Formula | C32H37N3OP+ |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | triphenyl-[5-piperidin-1-yl-2-(piperidin-1-ylmethyl)-1,3-oxazol-4-yl]phosphanium |
| SMILES | c1ccc([P+](c2ccccc2)(c2ccccc2)c2nc(CN3CCCCC3)oc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C32H37N3OP/c1-6-16-27(17-7-1)37(28-18-8-2-9-19-28,29-20-10-3-11-21-29)31-32(35-24-14-5-15-25-35)36-30(33-31)26-34-22-12-4-13-23-34/h1-3,6-11,16-21H,4-5,12-15,22-26H2/q+1 |
| InChIKey | RIPJXNVQDZXFQH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|