C30H28N2O2P+ — CID 3089961
[2-(furan-2-yl)-5-piperidin-1-yl-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 3089961) has the molecular formula C30H28N2O2P+ and a molecular weight of 479.54 g/mol. Its IUPAC name is [2-(furan-2-yl)-5-piperidin-1-yl-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(furan-2-yl)-5-piperidin-1-yl-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3089961 |
| Molecular Formula | C30H28N2O2P+ |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [2-(furan-2-yl)-5-piperidin-1-yl-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | c1ccc([P+](c2ccccc2)(c2ccccc2)c2nc(-c3ccco3)oc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H28N2O2P/c1-5-14-24(15-6-1)35(25-16-7-2-8-17-25,26-18-9-3-10-19-26)29-30(32-21-11-4-12-22-32)34-28(31-29)27-20-13-23-33-27/h1-3,5-10,13-20,23H,4,11-12,21-22H2/q+1 |
| InChIKey | CBWJQUXJFPFTRV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 42.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|