C26H22INO2PS+ — CID 126959135
[2-(furan-2-yl)-5-methylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide (PubChem CID 126959135) has the molecular formula C26H22INO2PS+ and a molecular weight of 570.41 g/mol. Its IUPAC name is [2-(furan-2-yl)-5-methylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide.
| Compound Name | [2-(furan-2-yl)-5-methylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126959135 |
| Molecular Formula | C26H22INO2PS+ |
| Molecular Weight | 570.41 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | [2-(furan-2-yl)-5-methylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
| SMILES | CSc1oc(-c2ccco2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C26H21NO2PS.HI/c1-31-26-25(27-24(29-26)23-18-11-19-28-23)30(20-12-5-2-6-13-20,21-14-7-3-8-15-21)22-16-9-4-10-17-22;/h2-19H,1H3;1H/q+1; |
| InChIKey | CQZWJAFDHKJLJP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|