C25H19NO2PS+ — CID 3089967
[2-(furan-2-yl)-5-sulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 3089967) has the molecular formula C25H19NO2PS+ and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-(furan-2-yl)-5-sulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(furan-2-yl)-5-sulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3089967 |
| Molecular Formula | C25H19NO2PS+ |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [2-(furan-2-yl)-5-sulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | Sc1oc(-c2ccco2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18NO2PS/c30-25-24(26-23(28-25)22-17-10-18-27-22)29(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-18H/p+1 |
| InChIKey | BYNQLJJDLFKXNW-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 39.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|