C44H36N2O2P2S2+2 — CID 3090616
[5-methylsulfanyl-2-(5-methylsulfanyl-4-triphenylphosphaniumyl-1,3-oxazol-2-yl)-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 3090616) has the molecular formula C44H36N2O2P2S2+2 and a molecular weight of 750.87 g/mol. Its IUPAC name is [5-methylsulfanyl-2-(5-methylsulfanyl-4-triphenylphosphaniumyl-1,3-oxazol-2-yl)-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [5-methylsulfanyl-2-(5-methylsulfanyl-4-triphenylphosphaniumyl-1,3-oxazol-2-yl)-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3090616 |
| Molecular Formula | C44H36N2O2P2S2+2 |
| Molecular Weight | 750.87 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | [5-methylsulfanyl-2-(5-methylsulfanyl-4-triphenylphosphaniumyl-1,3-oxazol-2-yl)-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | CSc1oc(-c2nc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(SC)o2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H36N2O2P2S2/c1-51-43-41(49(33-21-9-3-10-22-33,34-23-11-4-12-24-34)35-25-13-5-14-26-35)45-39(47-43)40-46-42(44(48-40)52-2)50(36-27-15-6-16-28-36,37-29-17-7-18-30-37)38-31-19-8-20-32-38/h3-32H,1-2H3/q+2 |
| InChIKey | BYNLWUZWXHGGNP-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.87 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|