C28H23NO2PS+ — CID 5073339
[2-(furan-3-yl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 5073339) has the molecular formula C28H23NO2PS+ and a molecular weight of 468.54 g/mol. Its IUPAC name is [2-(furan-3-yl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(furan-3-yl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 5073339 |
| Molecular Formula | C28H23NO2PS+ |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [2-(furan-3-yl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | C=CCSc1oc(-c2ccoc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO2PS/c1-2-20-33-28-27(29-26(31-28)22-18-19-30-21-22)32(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h2-19,21H,1,20H2/q+1 |
| InChIKey | WYNDPJTYPQMCMR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|