C28H20Cl2N2O5PS+ — CID 126957771
[2-(4-chlorophenyl)-5-thiocyanato-1,3-oxazol-4-yl]-triphenylphosphanium;perchloric acid (PubChem CID 126957771) has the molecular formula C28H20Cl2N2O5PS+ and a molecular weight of 598.42 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-5-thiocyanato-1,3-oxazol-4-yl]-triphenylphosphanium;perchloric acid.
| Compound Name | [2-(4-chlorophenyl)-5-thiocyanato-1,3-oxazol-4-yl]-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126957771 |
| Molecular Formula | C28H20Cl2N2O5PS+ |
| Molecular Weight | 598.42 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | [2-(4-chlorophenyl)-5-thiocyanato-1,3-oxazol-4-yl]-triphenylphosphanium;perchloric acid |
| SMILES | N#CSc1oc(-c2ccc(Cl)cc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C28H19ClN2OPS.ClHO4/c29-22-18-16-21(17-19-22)26-31-27(28(32-26)34-20-30)33(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25;2-1(3,4)5/h1-19H;(H,2,3,4,5)/q+1; |
| InChIKey | ZKMCYLMMNZJJIG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|