C29H23Cl2NOPS+ — CID 3091241
[2-(2,4-dichlorophenyl)-5-ethylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 3091241) has the molecular formula C29H23Cl2NOPS+ and a molecular weight of 535.46 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-5-ethylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(2,4-dichlorophenyl)-5-ethylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3091241 |
| Molecular Formula | C29H23Cl2NOPS+ |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-5-ethylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | CCSc1oc(-c2ccc(Cl)cc2Cl)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23Cl2NOPS/c1-2-35-29-28(32-27(33-29)25-19-18-21(30)20-26(25)31)34(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-20H,2H2,1H3/q+1 |
| InChIKey | VFQGDZQLMRDKFZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|