C28H23ClNO5PS — CID 12995343
[(5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenyl-λ5-phosphanyl] perchlorate (PubChem CID 12995343) has the molecular formula C28H23ClNO5PS and a molecular weight of 551.99 g/mol. Its IUPAC name is [(5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenyl-λ5-phosphanyl] perchlorate.
| Compound Name | [(5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenyl-λ5-phosphanyl] perchlorate |
|---|---|
| PubChem CID | 12995343 |
| Molecular Formula | C28H23ClNO5PS |
| Molecular Weight | 551.99 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | [(5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenyl-λ5-phosphanyl] perchlorate |
| SMILES | CSc1oc(-c2ccccc2)nc1P(O[Cl+3]([O-])([O-])[O-])(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23ClNO5PS/c1-37-28-27(30-26(34-28)22-14-6-2-7-15-22)36(35-29(31,32)33,23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | MDAWNGQUVDHXIN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.99 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|