C33H31ClN2O2P+ — CID 92904907
[2-(4-chlorophenyl)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 92904907) has the molecular formula C33H31ClN2O2P+ and a molecular weight of 554.05 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(4-chlorophenyl)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 92904907 |
| Molecular Formula | C33H31ClN2O2P+ |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | [2-(4-chlorophenyl)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | C[C@@H]1CN(c2oc(-c3ccc(Cl)cc3)nc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C33H31ClN2O2P/c1-24-22-36(23-25(2)37-24)33-32(35-31(38-33)26-18-20-27(34)21-19-26)39(28-12-6-3-7-13-28,29-14-8-4-9-15-29)30-16-10-5-11-17-30/h3-21,24-25H,22-23H2,1-2H3/q+1/t24-,25+ |
| InChIKey | YHCNGLADAVKKSW-PLQXJYEYSA-N |
| XLogP | 6.23 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|