C39H35N3O3P+ — CID 98135784
[2-(4-methoxyphenyl)-5-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1,3-oxazol-4-yl]-triphenylphosphanium (PubChem CID 98135784) has the molecular formula C39H35N3O3P+ and a molecular weight of 624.70 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-5-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1,3-oxazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(4-methoxyphenyl)-5-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1,3-oxazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 98135784 |
| Molecular Formula | C39H35N3O3P+ |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [2-(4-methoxyphenyl)-5-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1,3-oxazol-4-yl]-triphenylphosphanium |
| SMILES | COc1ccc(-c2nc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(N3C[C@@H]4C[C@@H](C3)c3cccc(=O)n3C4)o2)cc1 |
| InChI | InChI=1S/C39H35N3O3P/c1-44-31-22-20-29(21-23-31)37-40-38(39(45-37)41-25-28-24-30(27-41)35-18-11-19-36(43)42(35)26-28)46(32-12-5-2-6-13-32,33-14-7-3-8-15-33)34-16-9-4-10-17-34/h2-23,28,30H,24-27H2,1H3/q+1/t28-,30-/m0/s1 |
| InChIKey | GPHBSTSRDQGXKM-JDXGNMNLSA-N |
| XLogP | 5.76 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|