C31H28INOPS+ — CID 126957740
[2-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide (PubChem CID 126957740) has the molecular formula C31H28INOPS+ and a molecular weight of 620.52 g/mol. Its IUPAC name is [2-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide.
| Compound Name | [2-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126957740 |
| Molecular Formula | C31H28INOPS+ |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | [2-(4-methylphenyl)-5-prop-2-enylsulfanyl-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
| SMILES | C=CCSc1oc(-c2ccc(C)cc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C31H27NOPS.HI/c1-3-23-35-31-30(32-29(33-31)25-21-19-24(2)20-22-25)34(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28;/h3-22H,1,23H2,2H3;1H/q+1; |
| InChIKey | WCFVIEUFNBCHRZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|