C30H25ClINPS2+ — CID 126958036
[2-(4-chlorophenyl)-5-prop-2-enylsulfanyl-1,3-thiazol-4-yl]-triphenylphosphanium;hydroiodide (PubChem CID 126958036) has the molecular formula C30H25ClINPS2+ and a molecular weight of 657.00 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-5-prop-2-enylsulfanyl-1,3-thiazol-4-yl]-triphenylphosphanium;hydroiodide.
| Compound Name | [2-(4-chlorophenyl)-5-prop-2-enylsulfanyl-1,3-thiazol-4-yl]-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126958036 |
| Molecular Formula | C30H25ClINPS2+ |
| Molecular Weight | 657.00 g/mol |
| Exact Mass | 655.99 |
| IUPAC Name | [2-(4-chlorophenyl)-5-prop-2-enylsulfanyl-1,3-thiazol-4-yl]-triphenylphosphanium;hydroiodide |
| SMILES | C=CCSc1sc(-c2ccc(Cl)cc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C30H24ClNPS2.HI/c1-2-22-34-30-28(32-29(35-30)23-18-20-24(31)21-19-23)33(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27;/h2-21H,1,22H2;1H/q+1; |
| InChIKey | NZJLFIPIKJVTFG-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.00 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|