C31H27NOPS2+ — CID 3090638
[2-(4-methylphenyl)-5-(2-oxopropylsulfanyl)-1,3-thiazol-4-yl]-triphenylphosphanium (PubChem CID 3090638) has the molecular formula C31H27NOPS2+ and a molecular weight of 524.67 g/mol. Its IUPAC name is [2-(4-methylphenyl)-5-(2-oxopropylsulfanyl)-1,3-thiazol-4-yl]-triphenylphosphanium.
| Compound Name | [2-(4-methylphenyl)-5-(2-oxopropylsulfanyl)-1,3-thiazol-4-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 3090638 |
| Molecular Formula | C31H27NOPS2+ |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [2-(4-methylphenyl)-5-(2-oxopropylsulfanyl)-1,3-thiazol-4-yl]-triphenylphosphanium |
| SMILES | CC(=O)CSc1sc(-c2ccc(C)cc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27NOPS2/c1-23-18-20-25(21-19-23)30-32-29(31(36-30)35-22-24(2)33)34(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-21H,22H2,1-2H3/q+1 |
| InChIKey | GLJAEUGRDKDIEC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|