C34H29ClN3O8P — CID 91962887
[2-[(1,3-dioxoisoindol-2-yl)methyl]-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate (PubChem CID 91962887) has the molecular formula C34H29ClN3O8P and a molecular weight of 674.05 g/mol. Its IUPAC name is [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate.
| Compound Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 91962887 |
| Molecular Formula | C34H29ClN3O8P |
| Molecular Weight | 674.05 g/mol |
| Exact Mass | 673.14 |
| IUPAC Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(N2CCOCC2)o1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H29N3O4P.ClHO4/c38-32-28-18-10-11-19-29(28)33(39)37(32)24-30-35-31(34(41-30)36-20-22-40-23-21-36)42(25-12-4-1-5-13-25,26-14-6-2-7-15-26)27-16-8-3-9-17-27;2-1(3,4)5/h1-19H,20-24H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WTTPKVZZXQMVFU-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 168.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.05 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|