C26H24N2O3P+ — CID 11214889
(2-formyl-5-morpholin-4-yl-1,3-oxazol-4-yl)-triphenylphosphanium (PubChem CID 11214889) has the molecular formula C26H24N2O3P+ and a molecular weight of 443.46 g/mol. Its IUPAC name is (2-formyl-5-morpholin-4-yl-1,3-oxazol-4-yl)-triphenylphosphanium.
| Compound Name | (2-formyl-5-morpholin-4-yl-1,3-oxazol-4-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 11214889 |
| Molecular Formula | C26H24N2O3P+ |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2-formyl-5-morpholin-4-yl-1,3-oxazol-4-yl)-triphenylphosphanium |
| SMILES | O=Cc1nc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(N2CCOCC2)o1 |
| InChI | InChI=1S/C26H24N2O3P/c29-20-24-27-25(26(31-24)28-16-18-30-19-17-28)32(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,20H,16-19H2/q+1 |
| InChIKey | WGYGRXVIPOGKCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|