C30H31ClN3O8P — CID 10865095
[2-(morpholine-4-carbonyl)-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate (PubChem CID 10865095) has the molecular formula C30H31ClN3O8P and a molecular weight of 628.02 g/mol. Its IUPAC name is [2-(morpholine-4-carbonyl)-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate.
| Compound Name | [2-(morpholine-4-carbonyl)-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 10865095 |
| Molecular Formula | C30H31ClN3O8P |
| Molecular Weight | 628.02 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | [2-(morpholine-4-carbonyl)-5-morpholin-4-yl-1,3-oxazol-4-yl]-triphenylphosphanium perchlorate |
| SMILES | O=C(c1nc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(N2CCOCC2)o1)N1CCOCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H31N3O4P.ClHO4/c34-29(32-16-20-35-21-17-32)27-31-28(30(37-27)33-18-22-36-23-19-33)38(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26;2-1(3,4)5/h1-15H,16-23H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CLBFBZGUGKVPAR-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 160.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.02 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|