C19H18N2O4S — CID 1110868
4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]morpholine (PubChem CID 1110868) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]morpholine.
| Compound Name | 4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]morpholine |
|---|---|
| PubChem CID | 1110868 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]morpholine |
| SMILES | O=S(=O)(c1ccccc1)c1nc(-c2ccccc2)oc1N1CCOCC1 |
| InChI | InChI=1S/C19H18N2O4S/c22-26(23,16-9-5-2-6-10-16)18-19(21-11-13-24-14-12-21)25-17(20-18)15-7-3-1-4-8-15/h1-10H,11-14H2 |
| InChIKey | SXKOSUSBZLANOA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |