C21H22N2O3S — CID 18824785
4-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)-2-phenyl-1,3-oxazole (PubChem CID 18824785) has the molecular formula C21H22N2O3S and a molecular weight of 382.48 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)-2-phenyl-1,3-oxazole.
| Compound Name | 4-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 18824785 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)-2-phenyl-1,3-oxazole |
| SMILES | CC1CCN(c2oc(-c3ccccc3)nc2S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N2O3S/c1-16-12-14-23(15-13-16)21-20(27(24,25)18-10-6-3-7-11-18)22-19(26-21)17-8-4-2-5-9-17/h2-11,16H,12-15H2,1H3 |
| InChIKey | FDXMYEKKMYFBOW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |