C21H22N2O5S — CID 18890469
4-[4-(4-ethoxyphenyl)sulfonyl-2-phenyl-1,3-oxazol-5-yl]morpholine (PubChem CID 18890469) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[4-(4-ethoxyphenyl)sulfonyl-2-phenyl-1,3-oxazol-5-yl]morpholine.
| Compound Name | 4-[4-(4-ethoxyphenyl)sulfonyl-2-phenyl-1,3-oxazol-5-yl]morpholine |
|---|---|
| PubChem CID | 18890469 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-[4-(4-ethoxyphenyl)sulfonyl-2-phenyl-1,3-oxazol-5-yl]morpholine |
| SMILES | CCOc1ccc(S(=O)(=O)c2nc(-c3ccccc3)oc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H22N2O5S/c1-2-27-17-8-10-18(11-9-17)29(24,25)20-21(23-12-14-26-15-13-23)28-19(22-20)16-6-4-3-5-7-16/h3-11H,2,12-15H2,1H3 |
| InChIKey | CTQKUEPWDHOEJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |