C26H24FN3O3S — CID 2964756
5-(4-benzylpiperazin-1-yl)-4-(4-fluorophenyl)sulfonyl-2-phenyl-1,3-oxazole (PubChem CID 2964756) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is 5-(4-benzylpiperazin-1-yl)-4-(4-fluorophenyl)sulfonyl-2-phenyl-1,3-oxazole.
| Compound Name | 5-(4-benzylpiperazin-1-yl)-4-(4-fluorophenyl)sulfonyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 2964756 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-(4-benzylpiperazin-1-yl)-4-(4-fluorophenyl)sulfonyl-2-phenyl-1,3-oxazole |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1nc(-c2ccccc2)oc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H24FN3O3S/c27-22-11-13-23(14-12-22)34(31,32)25-26(33-24(28-25)21-9-5-2-6-10-21)30-17-15-29(16-18-30)19-20-7-3-1-4-8-20/h1-14H,15-19H2 |
| InChIKey | NXVDEWZBNNBPOM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |