C16H18N2O4S2 — CID 132553254
[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate (PubChem CID 132553254) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 132553254 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)CSC(=S)N1CCOCC1 |
| InChI | InChI=1S/C16H18N2O4S2/c19-11(10-24-16(23)17-5-7-22-8-6-17)9-18-14(20)12-3-1-2-4-13(12)15(18)21/h1-4,11,19H,5-10H2 |
| InChIKey | BKHMJXNBXPQAOU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|