About [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate
[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate (PubChem CID 132553254) has the molecular formula C16H18N2O4S2
and a molecular weight of 366.46 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate |
| PubChem CID | 132553254 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)CSC(=S)N1CCOCC1 |
| InChI | InChI=1S/C16H18N2O4S2/c19-11(10-24-16(23)17-5-7-22-8-6-17)9-18-14(20)12-3-1-2-4-13(12)15(18)21/h1-4,11,19H,5-10H2 |
| InChIKey | BKHMJXNBXPQAOU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate?
The IUPAC name of [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate (CID 132553254) is [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate.
What is the SMILES notation for [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate?
The canonical SMILES for [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate is O=C1c2ccccc2C(=O)N1CC(O)CSC(=S)N1CCOCC1.
What is the InChIKey of [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate?
The InChIKey is BKHMJXNBXPQAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S2/c19-11(10-24-16(23)17-5-7-22-8-6-17)9-18-14(20)12-3-1-2-4-13(12)15(18)21/h1-4,11,19H,5-10H2.
What are the key properties of [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate?
[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate has a molecular weight of 366.46 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl] morpholine-4-carbodithioate is sourced from PubChem (CID 132553254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).