C14H18N2O3S — CID 131194485
2-[3-(2-aminopropylsulfanyl)-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 131194485) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[3-(2-aminopropylsulfanyl)-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-aminopropylsulfanyl)-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 131194485 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[3-(2-aminopropylsulfanyl)-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | CC(N)CSCC(O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H18N2O3S/c1-9(15)7-20-8-10(17)6-16-13(18)11-4-2-3-5-12(11)14(16)19/h2-5,9-10,17H,6-8,15H2,1H3 |
| InChIKey | KQHASFITOFWVEU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|