C15H16F2N2O3 — CID 129358897
2-[(2S)-3-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 129358897) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-[(2S)-3-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-3-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129358897 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(2S)-3-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H](O)CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H16F2N2O3/c16-15(17)5-6-18(9-15)7-10(20)8-19-13(21)11-3-1-2-4-12(11)14(19)22/h1-4,10,20H,5-9H2/t10-/m0/s1 |
| InChIKey | ZQRDRBLBWSMZTJ-JTQLQIEISA-N |
| XLogP | 0.98 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|