C16H20N2O3S — CID 122154429
2-[(2R)-2-hydroxy-3-(3-methylthiomorpholin-4-yl)propyl]isoindole-1,3-dione (PubChem CID 122154429) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-(3-methylthiomorpholin-4-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-2-hydroxy-3-(3-methylthiomorpholin-4-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122154429 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-(3-methylthiomorpholin-4-yl)propyl]isoindole-1,3-dione |
| SMILES | CC1CSCCN1C[C@@H](O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H20N2O3S/c1-11-10-22-7-6-17(11)8-12(19)9-18-15(20)13-4-2-3-5-14(13)16(18)21/h2-5,11-12,19H,6-10H2,1H3/t11?,12-/m1/s1 |
| InChIKey | JZOQFDXZEPGDFG-PIJUOVFKSA-N |
| XLogP | 1.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|