C23H23N5O3S — CID 27780323
2-[2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 27780323) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 2-[2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 27780323 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSc1nnc(N2CCOCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H23N5O3S/c29-20-18-8-4-5-9-19(18)21(30)27(20)12-15-32-23-25-24-22(26-10-13-31-14-11-26)28(23)16-17-6-2-1-3-7-17/h1-9H,10-16H2 |
| InChIKey | WMQXSJLLDNKKKV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|