C24H27N5O2S — CID 2670286
2-[2-[[4-benzyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 2670286) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is 2-[2-[[4-benzyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[4-benzyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2670286 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[2-[[4-benzyl-5-[(1R)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | CC[C@H](c1nnc(SCCN2C(=O)c3ccccc3C2=O)n1Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C24H27N5O2S/c1-4-20(27(2)3)21-25-26-24(29(21)16-17-10-6-5-7-11-17)32-15-14-28-22(30)18-12-8-9-13-19(18)23(28)31/h5-13,20H,4,14-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | XGDBIYHSUOSVGA-HXUWFJFHSA-N |
| XLogP | 3.73 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|