C13H19NO5S — CID 87970462
ethane;methanesulfonic acid;5-methyl-2-phenyl-1,3-oxazol-4-ol (PubChem CID 87970462) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is ethane;methanesulfonic acid;5-methyl-2-phenyl-1,3-oxazol-4-ol.
| Compound Name | ethane;methanesulfonic acid;5-methyl-2-phenyl-1,3-oxazol-4-ol |
|---|---|
| PubChem CID | 87970462 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | ethane;methanesulfonic acid;5-methyl-2-phenyl-1,3-oxazol-4-ol |
| SMILES | CC.CS(=O)(=O)O.Cc1oc(-c2ccccc2)nc1O |
| InChI | InChI=1S/C10H9NO2.C2H6.CH4O3S/c1-7-9(12)11-10(13-7)8-5-3-2-4-6-8;1-2;1-5(2,3)4/h2-6,12H,1H3;1-2H3;1H3,(H,2,3,4) |
| InChIKey | MNMFTMHXHAKOAP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|