C11H11NOS — CID 11694132
5-methyl-4-methylsulfanyl-2-phenyl-1,3-oxazole (PubChem CID 11694132) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-methyl-4-methylsulfanyl-2-phenyl-1,3-oxazole.
| Compound Name | 5-methyl-4-methylsulfanyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 11694132 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-methyl-4-methylsulfanyl-2-phenyl-1,3-oxazole |
| SMILES | CSc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C11H11NOS/c1-8-11(14-2)12-10(13-8)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | TXCDRFSFIJWYQT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |