C13H10N2O — CID 82337949
5-methyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 82337949) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-methyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-methyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 82337949 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-methyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1ccc2nc(-c3ccccc3)oc2n1 |
| InChI | InChI=1S/C13H10N2O/c1-9-7-8-11-13(14-9)16-12(15-11)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | OKYOOQMBVSALNS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |