C29H24ClN5O2 — CID 161077471
5-chloro-2-phenyl-[1,3]oxazolo[5,4-b]pyridine;2-phenyl-5-piperidin-1-yl-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 161077471) has the molecular formula C29H24ClN5O2 and a molecular weight of 510.00 g/mol. Its IUPAC name is 5-chloro-2-phenyl-[1,3]oxazolo[5,4-b]pyridine;2-phenyl-5-piperidin-1-yl-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-chloro-2-phenyl-[1,3]oxazolo[5,4-b]pyridine;2-phenyl-5-piperidin-1-yl-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 161077471 |
| Molecular Formula | C29H24ClN5O2 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 5-chloro-2-phenyl-[1,3]oxazolo[5,4-b]pyridine;2-phenyl-5-piperidin-1-yl-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Clc1ccc2nc(-c3ccccc3)oc2n1.c1ccc(-c2nc3ccc(N4CCCCC4)nc3o2)cc1 |
| InChI | InChI=1S/C17H17N3O.C12H7ClN2O/c1-3-7-13(8-4-1)16-18-14-9-10-15(19-17(14)21-16)20-11-5-2-6-12-20;13-10-7-6-9-12(15-10)16-11(14-9)8-4-2-1-3-5-8/h1,3-4,7-10H,2,5-6,11-12H2;1-7H |
| InChIKey | UFLWLDNLQSVLKJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|