C12H6ClN3O3 — CID 89406475
5-chloro-2-(4-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 89406475) has the molecular formula C12H6ClN3O3 and a molecular weight of 275.65 g/mol. Its IUPAC name is 5-chloro-2-(4-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-chloro-2-(4-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 89406475 |
| Molecular Formula | C12H6ClN3O3 |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-chloro-2-(4-nitrophenyl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccc(Cl)nc3o2)cc1 |
| InChI | InChI=1S/C12H6ClN3O3/c13-10-6-5-9-12(15-10)19-11(14-9)7-1-3-8(4-2-7)16(17)18/h1-6H |
| InChIKey | HQMWRNYQURGBNP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|