C20H17N2O+ — CID 123727172
4-methyl-5-(2-methylphenyl)-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-4-ium (PubChem CID 123727172) has the molecular formula C20H17N2O+ and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-methyl-5-(2-methylphenyl)-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-4-ium.
| Compound Name | 4-methyl-5-(2-methylphenyl)-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-4-ium |
|---|---|
| PubChem CID | 123727172 |
| Molecular Formula | C20H17N2O+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-methyl-5-(2-methylphenyl)-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-4-ium |
| SMILES | Cc1ccccc1-c1ccc2nc(-c3ccccc3)oc2[n+]1C |
| InChI | InChI=1S/C20H17N2O/c1-14-8-6-7-11-16(14)18-13-12-17-20(22(18)2)23-19(21-17)15-9-4-3-5-10-15/h3-13H,1-2H3/q+1 |
| InChIKey | SAYKAEAHUSGVTH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|