C19H23N2O+ — CID 123931201
4-methyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-[1,3]oxazolo[5,4-b]pyridin-4-ium (PubChem CID 123931201) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-[1,3]oxazolo[5,4-b]pyridin-4-ium.
| Compound Name | 4-methyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-[1,3]oxazolo[5,4-b]pyridin-4-ium |
|---|---|
| PubChem CID | 123931201 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-methyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-[1,3]oxazolo[5,4-b]pyridin-4-ium |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3nc(C(C)C)oc3[n+]2C)c1 |
| InChI | InChI=1S/C19H23N2O/c1-11(2)18-20-16-7-8-17(21(6)19(16)22-18)15-10-12(3)9-13(4)14(15)5/h7-11H,1-6H3/q+1 |
| InChIKey | WZXBGPDQUNBFFL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|