C23H20NOS+ — CID 164756964
13-methyl-14-(2,3,5-trimethylphenyl)-11-oxa-15-thia-13-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16),13-heptaene (PubChem CID 164756964) has the molecular formula C23H20NOS+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 13-methyl-14-(2,3,5-trimethylphenyl)-11-oxa-15-thia-13-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16),13-heptaene.
| Compound Name | 13-methyl-14-(2,3,5-trimethylphenyl)-11-oxa-15-thia-13-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16),13-heptaene |
|---|---|
| PubChem CID | 164756964 |
| Molecular Formula | C23H20NOS+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 13-methyl-14-(2,3,5-trimethylphenyl)-11-oxa-15-thia-13-azoniatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16),13-heptaene |
| SMILES | Cc1cc(C)c(C)c(-c2sc3c4c(ccc5ccccc54)oc3[n+]2C)c1 |
| InChI | InChI=1S/C23H20NOS/c1-13-11-14(2)15(3)18(12-13)23-24(4)22-21(26-23)20-17-8-6-5-7-16(17)9-10-19(20)25-22/h5-12H,1-4H3/q+1 |
| InChIKey | LILOPLVRUICQEV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|