C17H19N2S+ — CID 123262871
2,4-dimethyl-5-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-b]pyridin-4-ium (PubChem CID 123262871) has the molecular formula C17H19N2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is 2,4-dimethyl-5-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-b]pyridin-4-ium.
| Compound Name | 2,4-dimethyl-5-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 123262871 |
| Molecular Formula | C17H19N2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2,4-dimethyl-5-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-b]pyridin-4-ium |
| SMILES | Cc1cc(C)c(C)c(-c2ccc3sc(C)nc3[n+]2C)c1 |
| InChI | InChI=1S/C17H19N2S/c1-10-8-11(2)12(3)14(9-10)15-6-7-16-17(19(15)5)18-13(4)20-16/h6-9H,1-5H3/q+1 |
| InChIKey | YUQRDKSWJOIKDD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|