C22H27N2+ — CID 161413854
6,7-dimethyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-1,6-naphthyridin-6-ium (PubChem CID 161413854) has the molecular formula C22H27N2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 6,7-dimethyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-1,6-naphthyridin-6-ium.
| Compound Name | 6,7-dimethyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-1,6-naphthyridin-6-ium |
|---|---|
| PubChem CID | 161413854 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 6,7-dimethyl-2-propan-2-yl-5-(2,3,5-trimethylphenyl)-1,6-naphthyridin-6-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc(C(C)C)nc3cc(C)[n+]2C)c1 |
| InChI | InChI=1S/C22H27N2/c1-13(2)20-9-8-18-21(23-20)12-16(5)24(7)22(18)19-11-14(3)10-15(4)17(19)6/h8-13H,1-7H3/q+1 |
| InChIKey | GLNIJQRVKATSIL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|